5-methoxy DALT
N,N-Diallyl-5-methoxytryptamine
CAS: 928822-98-4
Molecular Formula: C17H22N2O
5-methoxy DALT - Names and Identifiers
| Name | N,N-Diallyl-5-methoxytryptamine |
| Synonyms | 5-MeO-DALT 5-Meo-dalt 5-methoxy DALT 5-Methoxy-N,N-dially N,N-Dially-5-methoxytryptamine N,N-Diallyl-5-methoxytryptamine 5-Methoxy-N,N-diallyl-1H-indole-3-ethanamine 5-Methoxy-N,N-di-2-propen-1-yl-1H-indole-3-ethanaMine N-allyl-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]prop-2-en-1-amine N-allyl-N-(2-(5-methoxy-1H-indol-3-yl)ethyl)prop-2-en-1-amine |
| CAS | 928822-98-4 |
| InChI | InChI=1/C17H22N2O/c1-4-9-19(10-5-2)11-8-14-13-18-17-7-6-15(20-3)12-16(14)17/h4-7,12-13,18H,1-2,8-11H2,3H3 |
5-methoxy DALT - Physico-chemical Properties
| Molecular Formula | C17H22N2O |
| Molar Mass | 270.37 |
| Density | 1.059 |
| Boling Point | 422.8±45.0 °C(Predicted) |
| Flash Point | 209.5°C |
| Vapor Presure | 2.34E-07mmHg at 25°C |
| pKa | 16.90±0.30(Predicted) |
| Refractive Index | 1.586 |
5-methoxy DALT - Reference Information
| Use | It is a tryptine derivative used as component in> to produce its psychoactive effects. This compound is a standard f . |
Last Update：2024-04-09 19:05:15
